C19H22O4 — CID 169186070
methyl (2Z,4E)-5-(1-hydroxy-2,2-dimethyl-4-oxo-3H-naphthalen-1-yl)-3-methylpenta-2,4-dienoate (PubChem CID 169186070) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is methyl (2Z,4E)-5-(1-hydroxy-2,2-dimethyl-4-oxo-3H-naphthalen-1-yl)-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-(1-hydroxy-2,2-dimethyl-4-oxo-3H-naphthalen-1-yl)-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 169186070 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | methyl (2Z,4E)-5-(1-hydroxy-2,2-dimethyl-4-oxo-3H-naphthalen-1-yl)-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\C1(O)c2ccccc2C(=O)CC1(C)C |
| InChI | InChI=1S/C19H22O4/c1-13(11-17(21)23-4)9-10-19(22)15-8-6-5-7-14(15)16(20)12-18(19,2)3/h5-11,22H,12H2,1-4H3/b10-9+,13-11- |
| InChIKey | XDMPNGQPEINYHL-LTCRFSFDSA-N |
| XLogP | 3.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|