C23H38O4 — CID 169186220
(2S,4aR,8aR)-2-[(4R)-4-hydroxydodecyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one (PubChem CID 169186220) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (2S,4aR,8aR)-2-[(4R)-4-hydroxydodecyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one.
| Compound Name | (2S,4aR,8aR)-2-[(4R)-4-hydroxydodecyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
|---|---|
| PubChem CID | 169186220 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (2S,4aR,8aR)-2-[(4R)-4-hydroxydodecyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
| SMILES | CCCCCCCC[C@@H](O)CCC[C@H]1C=C(CO)[C@H]2CC(=O)C(C)=C[C@H]2O1 |
| InChI | InChI=1S/C23H38O4/c1-3-4-5-6-7-8-10-19(25)11-9-12-20-14-18(16-24)21-15-22(26)17(2)13-23(21)27-20/h13-14,19-21,23-25H,3-12,15-16H2,1-2H3/t19-,20+,21-,23-/m1/s1 |
| InChIKey | GITXKWGOPUFUFS-ADYITMSISA-N |
| XLogP | 4.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|