C25H40O4 — CID 169186222
(2S,4aR)-2-[(4S)-4-hydroxy-7,11-dimethyldodec-10-enyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one (PubChem CID 169186222) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (2S,4aR)-2-[(4S)-4-hydroxy-7,11-dimethyldodec-10-enyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one.
| Compound Name | (2S,4aR)-2-[(4S)-4-hydroxy-7,11-dimethyldodec-10-enyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
|---|---|
| PubChem CID | 169186222 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (2S,4aR)-2-[(4S)-4-hydroxy-7,11-dimethyldodec-10-enyl]-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
| SMILES | CC(C)=CCCC(C)CC[C@@H](O)CCC[C@H]1C=C(CO)[C@H]2CC(=O)C(C)=CC2O1 |
| InChI | InChI=1S/C25H40O4/c1-17(2)7-5-8-18(3)11-12-21(27)9-6-10-22-14-20(16-26)23-15-24(28)19(4)13-25(23)29-22/h7,13-14,18,21-23,25-27H,5-6,8-12,15-16H2,1-4H3/t18?,21-,22-,23+,25?/m0/s1 |
| InChIKey | OSLMOKLOPSJSDB-BZWLPNAESA-N |
| XLogP | 4.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|