C28H50O2 — CID 169186223
2,5-dimethyloct-2-ene;ethane;6-(4-methoxybutyl)-4,8-dimethylbicyclo[4.2.1]nona-4,7-dien-3-one (PubChem CID 169186223) has the molecular formula C28H50O2 and a molecular weight of 418.71 g/mol. Its IUPAC name is 2,5-dimethyloct-2-ene;ethane;6-(4-methoxybutyl)-4,8-dimethylbicyclo[4.2.1]nona-4,7-dien-3-one.
| Compound Name | 2,5-dimethyloct-2-ene;ethane;6-(4-methoxybutyl)-4,8-dimethylbicyclo[4.2.1]nona-4,7-dien-3-one |
|---|---|
| PubChem CID | 169186223 |
| Molecular Formula | C28H50O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | 2,5-dimethyloct-2-ene;ethane;6-(4-methoxybutyl)-4,8-dimethylbicyclo[4.2.1]nona-4,7-dien-3-one |
| SMILES | CC.CCCC(C)CC=C(C)C.COCCCCC12C=C(C)C(=O)CC(C1)C(C)=C2 |
| InChI | InChI=1S/C16H24O2.C10H20.C2H6/c1-12-9-16(6-4-5-7-18-3)10-13(2)15(17)8-14(12)11-16;1-5-6-10(4)8-7-9(2)3;1-2/h9-10,14H,4-8,11H2,1-3H3;7,10H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | YMDBRSHVOPEPEH-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|