C25H44O4 — CID 169186232
(4aR,8aR)-2-(4-hydroxybutyl)-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one;decane (PubChem CID 169186232) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (4aR,8aR)-2-(4-hydroxybutyl)-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one;decane.
| Compound Name | (4aR,8aR)-2-(4-hydroxybutyl)-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one;decane |
|---|---|
| PubChem CID | 169186232 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (4aR,8aR)-2-(4-hydroxybutyl)-4-(hydroxymethyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one;decane |
| SMILES | CC1=C[C@H]2OC(CCCCO)C=C(CO)[C@H]2CC1=O.CCCCCCCCCC |
| InChI | InChI=1S/C15H22O4.C10H22/c1-10-6-15-13(8-14(10)18)11(9-17)7-12(19-15)4-2-3-5-16;1-3-5-7-9-10-8-6-4-2/h6-7,12-13,15-17H,2-5,8-9H2,1H3;3-10H2,1-2H3/t12?,13-,15-;/m1./s1 |
| InChIKey | JEIXCXNGNZTQRA-GURJVRFHSA-N |
| XLogP | 5.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|