About 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one
3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one (PubChem CID 169186263) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one.
Molecular Properties
| Compound Name | 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
| PubChem CID | 169186263 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
| SMILES | CC1CCCOC12C=CC1CC(=O)C=CC1O2 |
| InChI | InChI=1S/C14H18O3/c1-10-3-2-8-16-14(10)7-6-11-9-12(15)4-5-13(11)17-14/h4-7,10-11,13H,2-3,8-9H2,1H3 |
| InChIKey | BOJPVIXQCVTRLN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one?
The IUPAC name of 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one (CID 169186263) is 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one.
What is the SMILES notation for 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one?
The canonical SMILES for 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one is CC1CCCOC12C=CC1CC(=O)C=CC1O2.
What is the InChIKey of 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one?
The InChIKey is BOJPVIXQCVTRLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-10-3-2-8-16-14(10)7-6-11-9-12(15)4-5-13(11)17-14/h4-7,10-11,13H,2-3,8-9H2,1H3.
What are the key properties of 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one?
3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one has a molecular weight of 234.29 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-methylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one is sourced from PubChem (CID 169186263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).