C22H40 — CID 169186779
ethane;1,2,3,4,6,6,9,9-octamethyl-4a,5,7,8,10,10a-hexahydrobenzo[8]annulene (PubChem CID 169186779) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is ethane;1,2,3,4,6,6,9,9-octamethyl-4a,5,7,8,10,10a-hexahydrobenzo[8]annulene.
| Compound Name | ethane;1,2,3,4,6,6,9,9-octamethyl-4a,5,7,8,10,10a-hexahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 169186779 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | ethane;1,2,3,4,6,6,9,9-octamethyl-4a,5,7,8,10,10a-hexahydrobenzo[8]annulene |
| SMILES | CC.CC1=C(C)C2CC(C)(C)CCC(C)(C)CC2C(C)=C1C |
| InChI | InChI=1S/C20H34.C2H6/c1-13-14(2)16(4)18-12-20(7,8)10-9-19(5,6)11-17(18)15(13)3;1-2/h17-18H,9-12H2,1-8H3;1-2H3 |
| InChIKey | PHOVTYHDHVXSQU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |