C18H16FIN2O2 — CID 16918695
N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-iodobenzamide (PubChem CID 16918695) has the molecular formula C18H16FIN2O2 and a molecular weight of 438.24 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-iodobenzamide.
| Compound Name | N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 16918695 |
| Molecular Formula | C18H16FIN2O2 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-iodobenzamide |
| SMILES | O=C(NCC1CC(=O)N(c2ccc(F)cc2)C1)c1ccccc1I |
| InChI | InChI=1S/C18H16FIN2O2/c19-13-5-7-14(8-6-13)22-11-12(9-17(22)23)10-21-18(24)15-3-1-2-4-16(15)20/h1-8,12H,9-11H2,(H,21,24) |
| InChIKey | SZXUAJBZOVTUKG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|