About ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal
ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal (PubChem CID 169186956) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal.
Molecular Properties
| Compound Name | ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal |
| PubChem CID | 169186956 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal |
| SMILES | C/C=C1/C=C(C)C=C/C1=N\C.CC.CC.CC/C=C/C=O |
| InChI | InChI=1S/C10H13N.C5H8O.2C2H6/c1-4-9-7-8(2)5-6-10(9)11-3;1-2-3-4-5-6;2*1-2/h4-7H,1-3H3;3-5H,2H2,1H3;2*1-2H3/b9-4-,11-10+;4-3+;; |
| InChIKey | OKNLEFPXWOUSJP-DFYCXARPSA-N |
| XLogP | 5.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal?
The IUPAC name of ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal (CID 169186956) is ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal.
What is the SMILES notation for ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal?
The canonical SMILES for ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal is C/C=C1/C=C(C)C=C/C1=N\C.CC.CC.CC/C=C/C=O.
What is the InChIKey of ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal?
The InChIKey is OKNLEFPXWOUSJP-DFYCXARPSA-N. The full InChI is InChI=1S/C10H13N.C5H8O.2C2H6/c1-4-9-7-8(2)5-6-10(9)11-3;1-2-3-4-5-6;2*1-2/h4-7H,1-3H3;3-5H,2H2,1H3;2*1-2H3/b9-4-,11-10+;4-3+;;.
What are the key properties of ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal?
ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal has a molecular weight of 291.48 g/mol, XLogP of 5.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6Z)-6-ethylidene-N,4-dimethylcyclohexa-2,4-dien-1-imine;(E)-pent-2-enal is sourced from PubChem (CID 169186956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).