C36H43N9 — CID 169186976
1-[2-[[[2-[4-(methylamino)piperidin-1-yl]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-N-(4-methylpenta-1,3-dien-2-yl)isoquinolin-6-amine (PubChem CID 169186976) has the molecular formula C36H43N9 and a molecular weight of 601.80 g/mol. Its IUPAC name is 1-[2-[[[2-[4-(methylamino)piperidin-1-yl]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-N-(4-methylpenta-1,3-dien-2-yl)isoquinolin-6-amine.
| Compound Name | 1-[2-[[[2-[4-(methylamino)piperidin-1-yl]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-N-(4-methylpenta-1,3-dien-2-yl)isoquinolin-6-amine |
|---|---|
| PubChem CID | 169186976 |
| Molecular Formula | C36H43N9 |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | 1-[2-[[[2-[4-(methylamino)piperidin-1-yl]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-N-(4-methylpenta-1,3-dien-2-yl)isoquinolin-6-amine |
| SMILES | C=C(C=C(C)C)Nc1ccc2c(-c3ccccc3CNc3nc(N4CCC(NC)CC4)nc4c(C(C)C)cnn34)nccc2c1 |
| InChI | InChI=1S/C36H43N9/c1-23(2)19-25(5)41-29-11-12-31-26(20-29)13-16-38-33(31)30-10-8-7-9-27(30)21-39-35-43-36(44-17-14-28(37-6)15-18-44)42-34-32(24(3)4)22-40-45(34)35/h7-13,16,19-20,22,24,28,37,41H,5,14-15,17-18,21H2,1-4,6H3,(H,39,42,43) |
| InChIKey | LRDYSTPGOOQMQL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|