About 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline
1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline (PubChem CID 169187211) has the molecular formula C16H18FN3O4S
and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline |
| PubChem CID | 169187211 |
| Molecular Formula | C16H18FN3O4S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline |
| SMILES | CC1(NS(=O)Oc2cc3c(=O)[nH]c(=O)n(CC4CC4)c3cc2F)CC1 |
| InChI | InChI=1S/C16H18FN3O4S/c1-16(4-5-16)19-25(23)24-13-6-10-12(7-11(13)17)20(8-9-2-3-9)15(22)18-14(10)21/h6-7,9,19H,2-5,8H2,1H3,(H,18,21,22) |
| InChIKey | GXBWVUOIYVAVRZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline?
The IUPAC name of 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline (CID 169187211) is 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline.
What is the SMILES notation for 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline?
The canonical SMILES for 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline is CC1(NS(=O)Oc2cc3c(=O)[nH]c(=O)n(CC4CC4)c3cc2F)CC1.
What is the InChIKey of 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline?
The InChIKey is GXBWVUOIYVAVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN3O4S/c1-16(4-5-16)19-25(23)24-13-6-10-12(7-11(13)17)20(8-9-2-3-9)15(22)18-14(10)21/h6-7,9,19H,2-5,8H2,1H3,(H,18,21,22).
What are the key properties of 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline?
1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline has a molecular weight of 367.40 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-7-fluoro-6-(1-methylcyclopropyl)sulfinamoyloxy-2,4-dioxoquinazoline is sourced from PubChem (CID 169187211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).