C15H20N2O2P+ — CID 169187282
[3-carbamoyl-4-(cyclopropylmethylamino)phenyl]-(1-methylcyclopropyl)-oxophosphanium (PubChem CID 169187282) has the molecular formula C15H20N2O2P+ and a molecular weight of 291.31 g/mol. Its IUPAC name is [3-carbamoyl-4-(cyclopropylmethylamino)phenyl]-(1-methylcyclopropyl)-oxophosphanium.
| Compound Name | [3-carbamoyl-4-(cyclopropylmethylamino)phenyl]-(1-methylcyclopropyl)-oxophosphanium |
|---|---|
| PubChem CID | 169187282 |
| Molecular Formula | C15H20N2O2P+ |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [3-carbamoyl-4-(cyclopropylmethylamino)phenyl]-(1-methylcyclopropyl)-oxophosphanium |
| SMILES | CC1([P+](=O)c2ccc(NCC3CC3)c(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C15H19N2O2P/c1-15(6-7-15)20(19)11-4-5-13(12(8-11)14(16)18)17-9-10-2-3-10/h4-5,8,10H,2-3,6-7,9H2,1H3,(H2-,16,17,18,19)/p+1 |
| InChIKey | DPKVZDXZAHKDBU-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|