C19H24N4O6S — CID 169187330
N-(1-methylcyclopropyl)-1-(oxetan-3-ylmethyl)-2,4-dioxoquinazoline-6-sulfonamide;prop-2-enamide (PubChem CID 169187330) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-(1-methylcyclopropyl)-1-(oxetan-3-ylmethyl)-2,4-dioxoquinazoline-6-sulfonamide;prop-2-enamide.
| Compound Name | N-(1-methylcyclopropyl)-1-(oxetan-3-ylmethyl)-2,4-dioxoquinazoline-6-sulfonamide;prop-2-enamide |
|---|---|
| PubChem CID | 169187330 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(1-methylcyclopropyl)-1-(oxetan-3-ylmethyl)-2,4-dioxoquinazoline-6-sulfonamide;prop-2-enamide |
| SMILES | C=CC(N)=O.CC1(NS(=O)(=O)c2ccc3c(c2)c(=O)[nH]c(=O)n3CC2COC2)CC1 |
| InChI | InChI=1S/C16H19N3O5S.C3H5NO/c1-16(4-5-16)18-25(22,23)11-2-3-13-12(6-11)14(20)17-15(21)19(13)7-10-8-24-9-10;1-2-3(4)5/h2-3,6,10,18H,4-5,7-9H2,1H3,(H,17,20,21);2H,1H2,(H2,4,5) |
| InChIKey | OYDMPFNUOMMLFO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|