C22H27Cl2N5O4S — CID 169187375
3-[1-(2,2-dichloroacetyl)azetidin-3-yl]-6-[(1-hydroxycyclopropyl)amino]sulfanyl-1-[(1-methylpyrrolidin-3-yl)methyl]quinazoline-2,4-dione (PubChem CID 169187375) has the molecular formula C22H27Cl2N5O4S and a molecular weight of 528.46 g/mol. Its IUPAC name is 3-[1-(2,2-dichloroacetyl)azetidin-3-yl]-6-[(1-hydroxycyclopropyl)amino]sulfanyl-1-[(1-methylpyrrolidin-3-yl)methyl]quinazoline-2,4-dione.
| Compound Name | 3-[1-(2,2-dichloroacetyl)azetidin-3-yl]-6-[(1-hydroxycyclopropyl)amino]sulfanyl-1-[(1-methylpyrrolidin-3-yl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 169187375 |
| Molecular Formula | C22H27Cl2N5O4S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 3-[1-(2,2-dichloroacetyl)azetidin-3-yl]-6-[(1-hydroxycyclopropyl)amino]sulfanyl-1-[(1-methylpyrrolidin-3-yl)methyl]quinazoline-2,4-dione |
| SMILES | CN1CCC(Cn2c(=O)n(C3CN(C(=O)C(Cl)Cl)C3)c(=O)c3cc(SNC4(O)CC4)ccc32)C1 |
| InChI | InChI=1S/C22H27Cl2N5O4S/c1-26-7-4-13(9-26)10-28-17-3-2-15(34-25-22(33)5-6-22)8-16(17)19(30)29(21(28)32)14-11-27(12-14)20(31)18(23)24/h2-3,8,13-14,18,25,33H,4-7,9-12H2,1H3 |
| InChIKey | PXZMASMGYLPKSQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|