C22H23ClFN5O4S2 — CID 169187500
3-[1-(2-chloro-2-fluoroacetyl)azetidin-3-yl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-hydroxycyclopropyl)amino]sulfanylquinazoline-2,4-dione (PubChem CID 169187500) has the molecular formula C22H23ClFN5O4S2 and a molecular weight of 540.04 g/mol. Its IUPAC name is 3-[1-(2-chloro-2-fluoroacetyl)azetidin-3-yl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-hydroxycyclopropyl)amino]sulfanylquinazoline-2,4-dione.
| Compound Name | 3-[1-(2-chloro-2-fluoroacetyl)azetidin-3-yl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-hydroxycyclopropyl)amino]sulfanylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 169187500 |
| Molecular Formula | C22H23ClFN5O4S2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 3-[1-(2-chloro-2-fluoroacetyl)azetidin-3-yl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-hydroxycyclopropyl)amino]sulfanylquinazoline-2,4-dione |
| SMILES | Cc1nc(C)c(Cn2c(=O)n(C3CN(C(=O)C(F)Cl)C3)c(=O)c3cc(SNC4(O)CC4)ccc32)s1 |
| InChI | InChI=1S/C22H23ClFN5O4S2/c1-11-17(34-12(2)25-11)10-28-16-4-3-14(35-26-22(33)5-6-22)7-15(16)19(30)29(21(28)32)13-8-27(9-13)20(31)18(23)24/h3-4,7,13,18,26,33H,5-6,8-10H2,1-2H3 |
| InChIKey | DLGHYWLOCOFHGP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|