C16H28 — CID 169188657
(3Z,5E)-3,6-dimethyl-8-propylundeca-1,3,5-triene (PubChem CID 169188657) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (3Z,5E)-3,6-dimethyl-8-propylundeca-1,3,5-triene.
| Compound Name | (3Z,5E)-3,6-dimethyl-8-propylundeca-1,3,5-triene |
|---|---|
| PubChem CID | 169188657 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (3Z,5E)-3,6-dimethyl-8-propylundeca-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C(/C)CC(CCC)CCC |
| InChI | InChI=1S/C16H28/c1-6-9-16(10-7-2)13-15(5)12-11-14(4)8-3/h8,11-12,16H,3,6-7,9-10,13H2,1-2,4-5H3/b14-11-,15-12+ |
| InChIKey | PNQYINLBIYEHEQ-KMUHKHSISA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|