About molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione
molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione (PubChem CID 169188670) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione.
Molecular Properties
| Compound Name | molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione |
| PubChem CID | 169188670 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione |
| SMILES | CC(C)c1ccc(NC2CCC(=O)NC2=O)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C14H18N2O2.2H2/c1-9(2)10-3-5-11(6-4-10)15-12-7-8-13(17)16-14(12)18;;/h3-6,9,12,15H,7-8H2,1-2H3,(H,16,17,18);2*1H |
| InChIKey | LIURTOUVTZRWTL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione?
The IUPAC name of molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione (CID 169188670) is molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione.
What is the SMILES notation for molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione?
The canonical SMILES for molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione is CC(C)c1ccc(NC2CCC(=O)NC2=O)cc1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione?
The InChIKey is LIURTOUVTZRWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2.2H2/c1-9(2)10-3-5-11(6-4-10)15-12-7-8-13(17)16-14(12)18;;/h3-6,9,12,15H,7-8H2,1-2H3,(H,16,17,18);2*1H.
What are the key properties of molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione?
molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione has a molecular weight of 250.34 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;3-(4-propan-2-ylanilino)piperidine-2,6-dione is sourced from PubChem (CID 169188670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).