C28H25ClF3N5S — CID 169188823
(NZ)-N-[amino(cyclopropyl)methylidene]-6-(4-chlorophenyl)-5-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboximidamide (PubChem CID 169188823) has the molecular formula C28H25ClF3N5S and a molecular weight of 556.06 g/mol. Its IUPAC name is (NZ)-N-[amino(cyclopropyl)methylidene]-6-(4-chlorophenyl)-5-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboximidamide.
| Compound Name | (NZ)-N-[amino(cyclopropyl)methylidene]-6-(4-chlorophenyl)-5-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboximidamide |
|---|---|
| PubChem CID | 169188823 |
| Molecular Formula | C28H25ClF3N5S |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | (NZ)-N-[amino(cyclopropyl)methylidene]-6-(4-chlorophenyl)-5-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboximidamide |
| SMILES | N/C(=N\C(=N\Sc1ccc(C(F)(F)F)cc1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)C1CC1 |
| InChI | InChI=1S/C28H25ClF3N5S/c29-22-12-8-19(9-13-22)25-24(18-4-2-1-3-5-18)16-17-37(35-25)27(34-26(33)20-6-7-20)36-38-23-14-10-21(11-15-23)28(30,31)32/h1-5,8-15,20,24H,6-7,16-17H2,(H2,33,34,36) |
| InChIKey | VFGQKNBJBQWGOF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|