About 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid
2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid (PubChem CID 169189011) has the molecular formula C22H18Cl2O4
and a molecular weight of 417.29 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid |
| PubChem CID | 169189011 |
| Molecular Formula | C22H18Cl2O4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid |
| SMILES | Cc1c(OCC(=O)O)cc(Cl)c(Cc2ccc(O)c(-c3ccccc3)c2)c1Cl |
| InChI | InChI=1S/C22H18Cl2O4/c1-13-20(28-12-21(26)27)11-18(23)17(22(13)24)10-14-7-8-19(25)16(9-14)15-5-3-2-4-6-15/h2-9,11,25H,10,12H2,1H3,(H,26,27) |
| InChIKey | RBVGLMYMTYOOTI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid?
The IUPAC name of 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid (CID 169189011) is 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid.
What is the SMILES notation for 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid?
The canonical SMILES for 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid is Cc1c(OCC(=O)O)cc(Cl)c(Cc2ccc(O)c(-c3ccccc3)c2)c1Cl.
What is the InChIKey of 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid?
The InChIKey is RBVGLMYMTYOOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2O4/c1-13-20(28-12-21(26)27)11-18(23)17(22(13)24)10-14-7-8-19(25)16(9-14)15-5-3-2-4-6-15/h2-9,11,25H,10,12H2,1H3,(H,26,27).
What are the key properties of 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid?
2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid has a molecular weight of 417.29 g/mol, XLogP of 5.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-4-[(4-hydroxy-3-phenylphenyl)methyl]-2-methylphenoxy]acetic acid is sourced from PubChem (CID 169189011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).