C20H23BCl2O4 — CID 169189132
3,5-dichloro-4-[[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenol (PubChem CID 169189132) has the molecular formula C20H23BCl2O4 and a molecular weight of 409.12 g/mol. Its IUPAC name is 3,5-dichloro-4-[[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenol.
| Compound Name | 3,5-dichloro-4-[[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 169189132 |
| Molecular Formula | C20H23BCl2O4 |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3,5-dichloro-4-[[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenol |
| SMILES | COc1ccc(Cc2c(Cl)cc(O)cc2Cl)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H23BCl2O4/c1-19(2)20(3,4)27-21(26-19)15-9-12(6-7-18(15)25-5)8-14-16(22)10-13(24)11-17(14)23/h6-7,9-11,24H,8H2,1-5H3 |
| InChIKey | XVAKWIKORNCLNT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|