methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate

C12H9F2NO2 — CID 169189296

IUPACmethyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate
SMILESC=Cc1c(F)cc(F)c2cc(C(=O)OC)[nH]c12
InChIInChI=1S/C12H9F2NO2/c1-3-6-8(13)5-9(14)7-4-10(12(16)17-2)15-11(6)7/h3-5,15H,1H2,2H3
InChIKeyYBJREVVCWLVQSQ-UHFFFAOYSA-N
MW237.20 g/mol
LogP2.88
Rot. Bonds2

About methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate

methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate (PubChem CID 169189296) has the molecular formula C12H9F2NO2 and a molecular weight of 237.20 g/mol. Its IUPAC name is methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate.

Molecular Properties

Compound Namemethyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate
PubChem CID169189296
Molecular FormulaC12H9F2NO2
Molecular Weight237.20 g/mol
Exact Mass237.06
IUPAC Namemethyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate
SMILESC=Cc1c(F)cc(F)c2cc(C(=O)OC)[nH]c12
InChIInChI=1S/C12H9F2NO2/c1-3-6-8(13)5-9(14)7-4-10(12(16)17-2)15-11(6)7/h3-5,15H,1H2,2H3
InChIKeyYBJREVVCWLVQSQ-UHFFFAOYSA-N
XLogP2.88
TPSA42.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.20
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate?
The IUPAC name of methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate (CID 169189296) is methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate?
The canonical SMILES for methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate is C=Cc1c(F)cc(F)c2cc(C(=O)OC)[nH]c12.
What is the InChIKey of methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate?
The InChIKey is YBJREVVCWLVQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO2/c1-3-6-8(13)5-9(14)7-4-10(12(16)17-2)15-11(6)7/h3-5,15H,1H2,2H3.
What are the key properties of methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate?
methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate has a molecular weight of 237.20 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate is sourced from PubChem (CID 169189296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).