C12H9F2NO2 — CID 169189296
methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate (PubChem CID 169189296) has the molecular formula C12H9F2NO2 and a molecular weight of 237.20 g/mol. Its IUPAC name is methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate.
| Compound Name | methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 169189296 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methyl 7-ethenyl-4,6-difluoro-1H-indole-2-carboxylate |
| SMILES | C=Cc1c(F)cc(F)c2cc(C(=O)OC)[nH]c12 |
| InChI | InChI=1S/C12H9F2NO2/c1-3-6-8(13)5-9(14)7-4-10(12(16)17-2)15-11(6)7/h3-5,15H,1H2,2H3 |
| InChIKey | YBJREVVCWLVQSQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |