About N-hexyl-N-octylformamide
N-hexyl-N-octylformamide (PubChem CID 169189817) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is N-hexyl-N-octylformamide.
Molecular Properties
| Compound Name | N-hexyl-N-octylformamide |
| PubChem CID | 169189817 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-hexyl-N-octylformamide |
| SMILES | CCCCCCCCN(C=O)CCCCCC |
| InChI | InChI=1S/C15H31NO/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | VEUSWOCZYIUTBH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-N-octylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-N-octylformamide?
The IUPAC name of N-hexyl-N-octylformamide (CID 169189817) is N-hexyl-N-octylformamide.
What is the SMILES notation for N-hexyl-N-octylformamide?
The canonical SMILES for N-hexyl-N-octylformamide is CCCCCCCCN(C=O)CCCCCC.
What is the InChIKey of N-hexyl-N-octylformamide?
The InChIKey is VEUSWOCZYIUTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2/h15H,3-14H2,1-2H3.
What are the key properties of N-hexyl-N-octylformamide?
N-hexyl-N-octylformamide has a molecular weight of 241.42 g/mol, XLogP of 4.39, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-N-octylformamide is sourced from PubChem (CID 169189817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).