C19H19ClN2O2 — CID 16918995
4-chloro-N-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]benzamide (PubChem CID 16918995) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-chloro-N-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16918995 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-chloro-N-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(N2CC(CNC(=O)c3ccc(Cl)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-13-2-8-17(9-3-13)22-12-14(10-18(22)23)11-21-19(24)15-4-6-16(20)7-5-15/h2-9,14H,10-12H2,1H3,(H,21,24) |
| InChIKey | MSMWOEJQYPWTTO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |