C12H17ClFN3 — CID 169190000
(1E,3Z,6E)-1-chloro-5-fluoro-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-1,3,7-triene-1,4-diamine (PubChem CID 169190000) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is (1E,3Z,6E)-1-chloro-5-fluoro-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-1,3,7-triene-1,4-diamine.
| Compound Name | (1E,3Z,6E)-1-chloro-5-fluoro-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-1,3,7-triene-1,4-diamine |
|---|---|
| PubChem CID | 169190000 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (1E,3Z,6E)-1-chloro-5-fluoro-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-1,3,7-triene-1,4-diamine |
| SMILES | C=C/C(=C\N=C)C(F)/C(N)=C(C)/C(C)=C(\N)Cl |
| InChI | InChI=1S/C12H17ClFN3/c1-5-9(6-17-4)10(14)11(15)7(2)8(3)12(13)16/h5-6,10H,1,4,15-16H2,2-3H3/b9-6+,11-7-,12-8- |
| InChIKey | OHPSMGVVWCVDJN-XXUGXXOISA-N |
| XLogP | 2.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|