About CID 169190312
CID 169190312 (PubChem CID 169190312) has the molecular formula C12H17AlO2
and a molecular weight of 220.25 g/mol.
Molecular Properties
| Compound Name | CID 169190312 |
| PubChem CID | 169190312 |
| Molecular Formula | C12H17AlO2 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | — |
| SMILES | CCOCc1ccc(COCC[Al])cc1 |
| InChI | InChI=1S/C12H17O2.Al/c1-3-13-9-11-5-7-12(8-6-11)10-14-4-2;/h5-8H,1,3-4,9-10H2,2H3; |
| InChIKey | KOLQDDMVDSMHDP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 169190312 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169190312?
The IUPAC name of CID 169190312 (CID 169190312) is not available.
What is the SMILES notation for CID 169190312?
The canonical SMILES for CID 169190312 is CCOCc1ccc(COCC[Al])cc1.
What is the InChIKey of CID 169190312?
The InChIKey is KOLQDDMVDSMHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O2.Al/c1-3-13-9-11-5-7-12(8-6-11)10-14-4-2;/h5-8H,1,3-4,9-10H2,2H3;.
What are the key properties of CID 169190312?
CID 169190312 has a molecular weight of 220.25 g/mol, XLogP of 2.33, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169190312 is sourced from PubChem (CID 169190312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).