About 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane
4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane (PubChem CID 169190332) has the molecular formula C16H23NS
and a molecular weight of 261.43 g/mol. Its IUPAC name is 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane.
Molecular Properties
| Compound Name | 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane |
| PubChem CID | 169190332 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane |
| SMILES | C=C(C1=CC2CC2C=C1)c1cscn1.CC.CC |
| InChI | InChI=1S/C12H11NS.2C2H6/c1-8(12-6-14-7-13-12)9-2-3-10-5-11(10)4-9;2*1-2/h2-4,6-7,10-11H,1,5H2;2*1-2H3 |
| InChIKey | BYIVELCFFDDCDE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane?
The IUPAC name of 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane (CID 169190332) is 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane.
What is the SMILES notation for 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane?
The canonical SMILES for 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane is C=C(C1=CC2CC2C=C1)c1cscn1.CC.CC.
What is the InChIKey of 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane?
The InChIKey is BYIVELCFFDDCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS.2C2H6/c1-8(12-6-14-7-13-12)9-2-3-10-5-11(10)4-9;2*1-2/h2-4,6-7,10-11H,1,5H2;2*1-2H3.
What are the key properties of 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane?
4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane has a molecular weight of 261.43 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-1,3-thiazole;ethane is sourced from PubChem (CID 169190332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).