About 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile
2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile (PubChem CID 169190692) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile |
| PubChem CID | 169190692 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile |
| SMILES | CO[C@H]1CC[C@H](C)C(C2C[C@H](C(C)C)CCC2CC#N)C1 |
| InChI | InChI=1S/C19H33NO/c1-13(2)16-7-6-15(9-10-20)19(11-16)18-12-17(21-4)8-5-14(18)3/h13-19H,5-9,11-12H2,1-4H3/t14-,15?,16+,17-,18?,19?/m0/s1 |
| InChIKey | AYLKQQHJUCTCKI-LQYOXDMMSA-N |
| XLogP | 5.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile?
The IUPAC name of 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile (CID 169190692) is 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile.
What is the SMILES notation for 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile?
The canonical SMILES for 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile is CO[C@H]1CC[C@H](C)C(C2C[C@H](C(C)C)CCC2CC#N)C1.
What is the InChIKey of 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile?
The InChIKey is AYLKQQHJUCTCKI-LQYOXDMMSA-N. The full InChI is InChI=1S/C19H33NO/c1-13(2)16-7-6-15(9-10-20)19(11-16)18-12-17(21-4)8-5-14(18)3/h13-19H,5-9,11-12H2,1-4H3/t14-,15?,16+,17-,18?,19?/m0/s1.
What are the key properties of 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile?
2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile has a molecular weight of 291.48 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-2-[(2S,5S)-5-methoxy-2-methylcyclohexyl]-4-propan-2-ylcyclohexyl]acetonitrile is sourced from PubChem (CID 169190692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).