About (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine
(3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine (PubChem CID 169190965) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine.
Molecular Properties
| Compound Name | (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine |
| PubChem CID | 169190965 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine |
| SMILES | CC(CCCC(F)(F)F)N[C@H]1CCCOC1 |
| InChI | InChI=1S/C11H20F3NO/c1-9(4-2-6-11(12,13)14)15-10-5-3-7-16-8-10/h9-10,15H,2-8H2,1H3/t9?,10-/m0/s1 |
| InChIKey | SNHLCSGHETZZIT-AXDSSHIGSA-N |
| XLogP | 2.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine?
The IUPAC name of (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine (CID 169190965) is (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine.
What is the SMILES notation for (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine?
The canonical SMILES for (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine is CC(CCCC(F)(F)F)N[C@H]1CCCOC1.
What is the InChIKey of (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine?
The InChIKey is SNHLCSGHETZZIT-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-9(4-2-6-11(12,13)14)15-10-5-3-7-16-8-10/h9-10,15H,2-8H2,1H3/t9?,10-/m0/s1.
What are the key properties of (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine?
(3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine has a molecular weight of 239.28 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(6,6,6-trifluorohexan-2-yl)oxan-3-amine is sourced from PubChem (CID 169190965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).