About N-(4,4-difluorocyclohexyl)oxan-3-amine
N-(4,4-difluorocyclohexyl)oxan-3-amine (PubChem CID 169190982) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)oxan-3-amine.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)oxan-3-amine |
| PubChem CID | 169190982 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)oxan-3-amine |
| SMILES | FC1(F)CCC(NC2CCCOC2)CC1 |
| InChI | InChI=1S/C11H19F2NO/c12-11(13)5-3-9(4-6-11)14-10-2-1-7-15-8-10/h9-10,14H,1-8H2 |
| InChIKey | XNDYVBXCRYLQSG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,4-difluorocyclohexyl)oxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)oxan-3-amine?
The IUPAC name of N-(4,4-difluorocyclohexyl)oxan-3-amine (CID 169190982) is N-(4,4-difluorocyclohexyl)oxan-3-amine.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)oxan-3-amine?
The canonical SMILES for N-(4,4-difluorocyclohexyl)oxan-3-amine is FC1(F)CCC(NC2CCCOC2)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)oxan-3-amine?
The InChIKey is XNDYVBXCRYLQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c12-11(13)5-3-9(4-6-11)14-10-2-1-7-15-8-10/h9-10,14H,1-8H2.
What are the key properties of N-(4,4-difluorocyclohexyl)oxan-3-amine?
N-(4,4-difluorocyclohexyl)oxan-3-amine has a molecular weight of 219.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)oxan-3-amine is sourced from PubChem (CID 169190982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).