C24H35F2N3O3 — CID 169190998
3,3-difluoro-N-propan-2-ylcyclohexan-1-amine;N-formyl-4-(6-methyl-3-oxo-1H-isoindol-2-yl)pentanamide (PubChem CID 169190998) has the molecular formula C24H35F2N3O3 and a molecular weight of 451.56 g/mol. Its IUPAC name is 3,3-difluoro-N-propan-2-ylcyclohexan-1-amine;N-formyl-4-(6-methyl-3-oxo-1H-isoindol-2-yl)pentanamide.
| Compound Name | 3,3-difluoro-N-propan-2-ylcyclohexan-1-amine;N-formyl-4-(6-methyl-3-oxo-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 169190998 |
| Molecular Formula | C24H35F2N3O3 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3,3-difluoro-N-propan-2-ylcyclohexan-1-amine;N-formyl-4-(6-methyl-3-oxo-1H-isoindol-2-yl)pentanamide |
| SMILES | CC(C)NC1CCCC(F)(F)C1.Cc1ccc2c(c1)CN(C(C)CCC(=O)NC=O)C2=O |
| InChI | InChI=1S/C15H18N2O3.C9H17F2N/c1-10-3-5-13-12(7-10)8-17(15(13)20)11(2)4-6-14(19)16-9-18;1-7(2)12-8-4-3-5-9(10,11)6-8/h3,5,7,9,11H,4,6,8H2,1-2H3,(H,16,18,19);7-8,12H,3-6H2,1-2H3 |
| InChIKey | KPWVGRYCXWBWOK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|