C22H29N9O — CID 169191119
4-amino-5,22-bis(methylamino)-2,9,16,20,21,24-hexazapentacyclo[16.5.2.13,7.09,14.021,25]hexacosa-1(24),3,5,7(26),18(25),19,22-heptaen-17-one (PubChem CID 169191119) has the molecular formula C22H29N9O and a molecular weight of 435.54 g/mol. Its IUPAC name is 4-amino-5,22-bis(methylamino)-2,9,16,20,21,24-hexazapentacyclo[16.5.2.13,7.09,14.021,25]hexacosa-1(24),3,5,7(26),18(25),19,22-heptaen-17-one.
| Compound Name | 4-amino-5,22-bis(methylamino)-2,9,16,20,21,24-hexazapentacyclo[16.5.2.13,7.09,14.021,25]hexacosa-1(24),3,5,7(26),18(25),19,22-heptaen-17-one |
|---|---|
| PubChem CID | 169191119 |
| Molecular Formula | C22H29N9O |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-amino-5,22-bis(methylamino)-2,9,16,20,21,24-hexazapentacyclo[16.5.2.13,7.09,14.021,25]hexacosa-1(24),3,5,7(26),18(25),19,22-heptaen-17-one |
| SMILES | CNc1cc2cc(c1N)Nc1cc(NC)n3ncc(c3n1)C(=O)NCC1CCCCN1C2 |
| InChI | InChI=1S/C22H29N9O/c1-24-16-7-13-8-17(20(16)23)28-18-9-19(25-2)31-21(29-18)15(11-27-31)22(32)26-10-14-5-3-4-6-30(14)12-13/h7-9,11,14,24-25H,3-6,10,12,23H2,1-2H3,(H,26,32)(H,28,29) |
| InChIKey | IDBSLNIAMPVYMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|