C20H25N9O2 — CID 169191167
12-amino-11-[amino(methyl)amino]-17-(methylamino)-7-oxa-3,14,18,19,22-pentazapentacyclo[13.5.2.13,6.19,13.018,21]tetracosa-1(21),9(23),10,12,15(22),16,19-heptaen-2-one (PubChem CID 169191167) has the molecular formula C20H25N9O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 12-amino-11-[amino(methyl)amino]-17-(methylamino)-7-oxa-3,14,18,19,22-pentazapentacyclo[13.5.2.13,6.19,13.018,21]tetracosa-1(21),9(23),10,12,15(22),16,19-heptaen-2-one.
| Compound Name | 12-amino-11-[amino(methyl)amino]-17-(methylamino)-7-oxa-3,14,18,19,22-pentazapentacyclo[13.5.2.13,6.19,13.018,21]tetracosa-1(21),9(23),10,12,15(22),16,19-heptaen-2-one |
|---|---|
| PubChem CID | 169191167 |
| Molecular Formula | C20H25N9O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 12-amino-11-[amino(methyl)amino]-17-(methylamino)-7-oxa-3,14,18,19,22-pentazapentacyclo[13.5.2.13,6.19,13.018,21]tetracosa-1(21),9(23),10,12,15(22),16,19-heptaen-2-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)N1CCC(C1)OCc1cc(c(N)c(N(C)N)c1)N2 |
| InChI | InChI=1S/C20H25N9O2/c1-23-17-7-16-25-14-5-11(6-15(18(14)21)27(2)22)10-31-12-3-4-28(9-12)20(30)13-8-24-29(17)19(13)26-16/h5-8,12,23H,3-4,9-10,21-22H2,1-2H3,(H,25,26) |
| InChIKey | WBZINBQPMCRQFW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 139.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|