C20H24N8O2 — CID 169191217
4-methanimidoyl-11-methyl-5,18-bis(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one (PubChem CID 169191217) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 4-methanimidoyl-11-methyl-5,18-bis(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one.
| Compound Name | 4-methanimidoyl-11-methyl-5,18-bis(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 169191217 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-methanimidoyl-11-methyl-5,18-bis(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one |
| SMILES | [H]/N=C/c1c(NC)cc2cc1Nc1cc(NC)c3ncc(n3n1)C(=O)NC(C)COC2 |
| InChI | InChI=1S/C20H24N8O2/c1-11-9-30-10-12-4-14(22-2)13(7-21)15(5-12)26-18-6-16(23-3)19-24-8-17(20(29)25-11)28(19)27-18/h4-8,11,21-23H,9-10H2,1-3H3,(H,25,29)(H,26,27)/b21-7+ |
| InChIKey | RKNZEUSROYGMBI-QPSGOUHRSA-N |
| XLogP | 2.20 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|