C20H20N8O — CID 169191399
12-methyl-24-(methylamino)-2,4,5,7,11,14,16-heptazapentacyclo[13.6.2.23,6.05,9.019,23]pentacosa-1(22),3,6,8,15,17,19(23),20,24-nonaen-10-one (PubChem CID 169191399) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 12-methyl-24-(methylamino)-2,4,5,7,11,14,16-heptazapentacyclo[13.6.2.23,6.05,9.019,23]pentacosa-1(22),3,6,8,15,17,19(23),20,24-nonaen-10-one.
| Compound Name | 12-methyl-24-(methylamino)-2,4,5,7,11,14,16-heptazapentacyclo[13.6.2.23,6.05,9.019,23]pentacosa-1(22),3,6,8,15,17,19(23),20,24-nonaen-10-one |
|---|---|
| PubChem CID | 169191399 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 12-methyl-24-(methylamino)-2,4,5,7,11,14,16-heptazapentacyclo[13.6.2.23,6.05,9.019,23]pentacosa-1(22),3,6,8,15,17,19(23),20,24-nonaen-10-one |
| SMILES | CNc1cc2nn3c(cnc13)C(=O)NC(C)CNc1nccc3ccc(cc13)N2 |
| InChI | InChI=1S/C20H20N8O/c1-11-9-23-18-14-7-13(4-3-12(14)5-6-22-18)26-17-8-15(21-2)19-24-10-16(20(29)25-11)28(19)27-17/h3-8,10-11,21H,9H2,1-2H3,(H,22,23)(H,25,29)(H,26,27) |
| InChIKey | JBOITOCOFSZWOZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|