C13H27NO3 — CID 169191728
ethane;4-methylpentanoic acid;5-methylpyrrolidin-2-one (PubChem CID 169191728) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is ethane;4-methylpentanoic acid;5-methylpyrrolidin-2-one.
| Compound Name | ethane;4-methylpentanoic acid;5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 169191728 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | ethane;4-methylpentanoic acid;5-methylpyrrolidin-2-one |
| SMILES | CC.CC(C)CCC(=O)O.CC1CCC(=O)N1 |
| InChI | InChI=1S/C6H12O2.C5H9NO.C2H6/c1-5(2)3-4-6(7)8;1-4-2-3-5(7)6-4;1-2/h5H,3-4H2,1-2H3,(H,7,8);4H,2-3H2,1H3,(H,6,7);1-2H3 |
| InChIKey | OFQPRPGEYRPRSB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |