C17H20O5 — CID 169192162
(1S,3S,7R,8S,10S)-10-methyl-4-methylidene-6,16,18-trioxatetracyclo[12.4.0.03,7.08,10]octadec-13-ene-5,17-dione (PubChem CID 169192162) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1S,3S,7R,8S,10S)-10-methyl-4-methylidene-6,16,18-trioxatetracyclo[12.4.0.03,7.08,10]octadec-13-ene-5,17-dione.
| Compound Name | (1S,3S,7R,8S,10S)-10-methyl-4-methylidene-6,16,18-trioxatetracyclo[12.4.0.03,7.08,10]octadec-13-ene-5,17-dione |
|---|---|
| PubChem CID | 169192162 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (1S,3S,7R,8S,10S)-10-methyl-4-methylidene-6,16,18-trioxatetracyclo[12.4.0.03,7.08,10]octadec-13-ene-5,17-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C[C@]3(C)CCC=C3COC(=O)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C17H20O5/c1-9-11-6-13-10(8-20-16(19)21-13)4-3-5-17(2)7-12(17)14(11)22-15(9)18/h4,11-14H,1,3,5-8H2,2H3/t11-,12+,13-,14-,17-/m0/s1 |
| InChIKey | QFASQHLJHJZRTM-WLZFUECHSA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|