C22H26O5S — CID 169192248
(1S,2R,4R,11S)-8-(methoxymethyl)-4-methyl-12-methylidene-7-phenylsulfanyl-3,14-dioxatricyclo[9.3.0.02,4]tetradecane-9,13-dione (PubChem CID 169192248) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is (1S,2R,4R,11S)-8-(methoxymethyl)-4-methyl-12-methylidene-7-phenylsulfanyl-3,14-dioxatricyclo[9.3.0.02,4]tetradecane-9,13-dione.
| Compound Name | (1S,2R,4R,11S)-8-(methoxymethyl)-4-methyl-12-methylidene-7-phenylsulfanyl-3,14-dioxatricyclo[9.3.0.02,4]tetradecane-9,13-dione |
|---|---|
| PubChem CID | 169192248 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (1S,2R,4R,11S)-8-(methoxymethyl)-4-methyl-12-methylidene-7-phenylsulfanyl-3,14-dioxatricyclo[9.3.0.02,4]tetradecane-9,13-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3O[C@]3(C)CCC(Sc3ccccc3)C(COC)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C22H26O5S/c1-13-15-11-17(23)16(12-25-3)18(28-14-7-5-4-6-8-14)9-10-22(2)20(27-22)19(15)26-21(13)24/h4-8,15-16,18-20H,1,9-12H2,2-3H3/t15-,16?,18?,19-,20+,22+/m0/s1 |
| InChIKey | MYBRYUQARHCCDM-UFTJKIAWSA-N |
| XLogP | 3.42 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|