C21H24F3N5O2S — CID 169192448
N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-1-(2,4,6-trifluoro-N-methylanilino)sulfanylpiperidine-2-carboxamide (PubChem CID 169192448) has the molecular formula C21H24F3N5O2S and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-1-(2,4,6-trifluoro-N-methylanilino)sulfanylpiperidine-2-carboxamide.
| Compound Name | N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-1-(2,4,6-trifluoro-N-methylanilino)sulfanylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 169192448 |
| Molecular Formula | C21H24F3N5O2S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-1-(2,4,6-trifluoro-N-methylanilino)sulfanylpiperidine-2-carboxamide |
| SMILES | CN(SN1CCCCC1C(=O)NCC(=O)NCc1cccnc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C21H24F3N5O2S/c1-28(20-16(23)9-15(22)10-17(20)24)32-29-8-3-2-6-18(29)21(31)27-13-19(30)26-12-14-5-4-7-25-11-14/h4-5,7,9-11,18H,2-3,6,8,12-13H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | ZFMTXQSRYJCYEG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|