C20H31N4O3+ — CID 169192454
(2R)-N-[(2R)-1-[[1-(1-hydroxypyridin-1-ium-3-yl)cyclopropyl]amino]-4-methyl-1-oxopentan-2-yl]piperidine-2-carboxamide (PubChem CID 169192454) has the molecular formula C20H31N4O3+ and a molecular weight of 375.49 g/mol. Its IUPAC name is (2R)-N-[(2R)-1-[[1-(1-hydroxypyridin-1-ium-3-yl)cyclopropyl]amino]-4-methyl-1-oxopentan-2-yl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[(2R)-1-[[1-(1-hydroxypyridin-1-ium-3-yl)cyclopropyl]amino]-4-methyl-1-oxopentan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 169192454 |
| Molecular Formula | C20H31N4O3+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (2R)-N-[(2R)-1-[[1-(1-hydroxypyridin-1-ium-3-yl)cyclopropyl]amino]-4-methyl-1-oxopentan-2-yl]piperidine-2-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H]1CCCCN1)C(=O)NC1(c2ccc[n+](O)c2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-14(2)12-17(22-18(25)16-7-3-4-10-21-16)19(26)23-20(8-9-20)15-6-5-11-24(27)13-15/h5-6,11,13-14,16-17,21H,3-4,7-10,12H2,1-2H3,(H2-,22,23,25,26,27)/p+1/t16-,17-/m1/s1 |
| InChIKey | AXALHSIQOOVQEF-IAGOWNOFSA-O |
| XLogP | 0.99 |
| TPSA | 94.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|