C18H29N3 — CID 169192599
(5E,7Z,9Z)-2-N-(2-aminoprop-2-enyl)-3-N-but-1-en-2-ylundeca-1,5,7,9-tetraene-2,3-diamine (PubChem CID 169192599) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (5E,7Z,9Z)-2-N-(2-aminoprop-2-enyl)-3-N-but-1-en-2-ylundeca-1,5,7,9-tetraene-2,3-diamine.
| Compound Name | (5E,7Z,9Z)-2-N-(2-aminoprop-2-enyl)-3-N-but-1-en-2-ylundeca-1,5,7,9-tetraene-2,3-diamine |
|---|---|
| PubChem CID | 169192599 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (5E,7Z,9Z)-2-N-(2-aminoprop-2-enyl)-3-N-but-1-en-2-ylundeca-1,5,7,9-tetraene-2,3-diamine |
| SMILES | C=C(N)CNC(=C)C(C/C=C/C=C\C=C/C)NC(=C)CC |
| InChI | InChI=1S/C18H29N3/c1-6-8-9-10-11-12-13-18(21-16(4)7-2)17(5)20-14-15(3)19/h6,8-12,18,20-21H,3-5,7,13-14,19H2,1-2H3/b8-6-,10-9-,12-11+ |
| InChIKey | XPFWMJVWTWBXTC-TYMHJJGGSA-N |
| XLogP | 3.52 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|