C22H30N4O3 — CID 169192769
3-[[1-[5-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid (PubChem CID 169192769) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[[1-[5-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid.
| Compound Name | 3-[[1-[5-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 169192769 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 3-[[1-[5-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid |
| SMILES | CC1(C)CCC(c2nc(N3CCc4cc(CNCCC(=O)O)ccc43)no2)CC1 |
| InChI | InChI=1S/C22H30N4O3/c1-22(2)9-5-16(6-10-22)20-24-21(25-29-20)26-12-8-17-13-15(3-4-18(17)26)14-23-11-7-19(27)28/h3-4,13,16,23H,5-12,14H2,1-2H3,(H,27,28) |
| InChIKey | RHQMKSLGVZBEFK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|