C10H16FNO2 — CID 169193086
(3R,6R,7aS)-3-tert-butyl-6-fluoro-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 169193086) has the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. Its IUPAC name is (3R,6R,7aS)-3-tert-butyl-6-fluoro-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,6R,7aS)-3-tert-butyl-6-fluoro-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 169193086 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (3R,6R,7aS)-3-tert-butyl-6-fluoro-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CC(C)(C)[C@H]1OC(=O)[C@@H]2C[C@@H](F)CN21 |
| InChI | InChI=1S/C10H16FNO2/c1-10(2,3)9-12-5-6(11)4-7(12)8(13)14-9/h6-7,9H,4-5H2,1-3H3/t6-,7+,9-/m1/s1 |
| InChIKey | DTJCRDCPOXSZJY-BKPPORCPSA-N |
| XLogP | 1.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |