C18H28F2N2O4 — CID 169193173
methyl (1R,2S,5S)-3-[(2S)-2-(2,2-difluoropropanoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 169193173) has the molecular formula C18H28F2N2O4 and a molecular weight of 374.43 g/mol. Its IUPAC name is methyl (1R,2S,5S)-3-[(2S)-2-(2,2-difluoropropanoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-3-[(2S)-2-(2,2-difluoropropanoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 169193173 |
| Molecular Formula | C18H28F2N2O4 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl (1R,2S,5S)-3-[(2S)-2-(2,2-difluoropropanoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(C)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C18H28F2N2O4/c1-16(2,3)12(21-15(25)18(6,19)20)13(23)22-8-9-10(17(9,4)5)11(22)14(24)26-7/h9-12H,8H2,1-7H3,(H,21,25)/t9-,10-,11-,12+/m0/s1 |
| InChIKey | YONPZYXNHQBFLY-FIQHERPVSA-N |
| XLogP | 1.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |