About propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide
propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide (PubChem CID 169193293) has the molecular formula C11H22F3NO2
and a molecular weight of 257.30 g/mol. Its IUPAC name is propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide.
Molecular Properties
| Compound Name | propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide |
| PubChem CID | 169193293 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide |
| SMILES | CC(C)(C)OCCNC(=O)C(F)(F)F.CCC |
| InChI | InChI=1S/C8H14F3NO2.C3H8/c1-7(2,3)14-5-4-12-6(13)8(9,10)11;1-3-2/h4-5H2,1-3H3,(H,12,13);3H2,1-2H3 |
| InChIKey | DCHFJEDIVDWPOX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide?
The IUPAC name of propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide (CID 169193293) is propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide.
What is the SMILES notation for propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide?
The canonical SMILES for propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide is CC(C)(C)OCCNC(=O)C(F)(F)F.CCC.
What is the InChIKey of propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide?
The InChIKey is DCHFJEDIVDWPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2.C3H8/c1-7(2,3)14-5-4-12-6(13)8(9,10)11;1-3-2/h4-5H2,1-3H3,(H,12,13);3H2,1-2H3.
What are the key properties of propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide?
propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide has a molecular weight of 257.30 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;2,2,2-trifluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]acetamide is sourced from PubChem (CID 169193293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).