About 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one
5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one (PubChem CID 169193331) has the molecular formula C13H21FN2O
and a molecular weight of 240.32 g/mol. Its IUPAC name is 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one |
| PubChem CID | 169193331 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one |
| SMILES | CC(C)[C@@H](Nc1cc(=O)[nH]cc1F)C(C)(C)C |
| InChI | InChI=1S/C13H21FN2O/c1-8(2)12(13(3,4)5)16-10-6-11(17)15-7-9(10)14/h6-8,12H,1-5H3,(H2,15,16,17)/t12-/m1/s1 |
| InChIKey | LYSKVMDCTFNSQZ-GFCCVEGCSA-N |
| XLogP | 3.00 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one?
The IUPAC name of 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one (CID 169193331) is 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one.
What is the SMILES notation for 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one?
The canonical SMILES for 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one is CC(C)[C@@H](Nc1cc(=O)[nH]cc1F)C(C)(C)C.
What is the InChIKey of 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one?
The InChIKey is LYSKVMDCTFNSQZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H21FN2O/c1-8(2)12(13(3,4)5)16-10-6-11(17)15-7-9(10)14/h6-8,12H,1-5H3,(H2,15,16,17)/t12-/m1/s1.
What are the key properties of 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one?
5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one has a molecular weight of 240.32 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-[[(3R)-2,2,4-trimethylpentan-3-yl]amino]-1H-pyridin-2-one is sourced from PubChem (CID 169193331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).