C21H30F3N5O5 — CID 169193403
(2R,3R)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-methoxypyrrolidine-2-carboxamide (PubChem CID 169193403) has the molecular formula C21H30F3N5O5 and a molecular weight of 489.50 g/mol. Its IUPAC name is (2R,3R)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2R,3R)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169193403 |
| Molecular Formula | C21H30F3N5O5 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2R,3R)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@@H]1CCN(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)[C@H]1C(=O)N[C@H](C#N)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C21H30F3N5O5/c1-20(2,3)15(28-19(33)21(22,23)24)18(32)29-8-6-13(34-4)14(29)17(31)27-12(10-25)9-11-5-7-26-16(11)30/h11-15H,5-9H2,1-4H3,(H,26,30)(H,27,31)(H,28,33)/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | ZAQBLFQOZPFKFK-VQJWOFKYSA-N |
| XLogP | 0.23 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |