C18H28F2N2O4 — CID 169193558
ethyl (3S,3aS,6aR)-2-[(2S)-2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 169193558) has the molecular formula C18H28F2N2O4 and a molecular weight of 374.43 g/mol. Its IUPAC name is ethyl (3S,3aS,6aR)-2-[(2S)-2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | ethyl (3S,3aS,6aR)-2-[(2S)-2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 169193558 |
| Molecular Formula | C18H28F2N2O4 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl (3S,3aS,6aR)-2-[(2S)-2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(=O)C(C)(F)F)C(C)C |
| InChI | InChI=1S/C18H28F2N2O4/c1-5-26-16(24)14-12-8-6-7-11(12)9-22(14)15(23)13(10(2)3)21-17(25)18(4,19)20/h10-14H,5-9H2,1-4H3,(H,21,25)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | SGAHYHOYTQBBDL-XUXIUFHCSA-N |
| XLogP | 1.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |