C11H11N3O2 — CID 169193568
ethyl (E)-3-(triazolo[1,5-a]pyridin-6-yl)prop-2-enoate (PubChem CID 169193568) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is ethyl (E)-3-(triazolo[1,5-a]pyridin-6-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(triazolo[1,5-a]pyridin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 169193568 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | ethyl (E)-3-(triazolo[1,5-a]pyridin-6-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc2cnnn2c1 |
| InChI | InChI=1S/C11H11N3O2/c1-2-16-11(15)6-4-9-3-5-10-7-12-13-14(10)8-9/h3-8H,2H2,1H3/b6-4+ |
| InChIKey | VMBKINIIZTWGMY-GQCTYLIASA-N |
| XLogP | 1.31 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|