C30H28N2O4 — CID 169193829
methyl 2-(benzhydrylideneamino)-2-[1-[(4-methoxyphenyl)methyl]-5-methyl-2-oxo-4-pyridinyl]acetate (PubChem CID 169193829) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 2-(benzhydrylideneamino)-2-[1-[(4-methoxyphenyl)methyl]-5-methyl-2-oxo-4-pyridinyl]acetate.
| Compound Name | methyl 2-(benzhydrylideneamino)-2-[1-[(4-methoxyphenyl)methyl]-5-methyl-2-oxo-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 169193829 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | methyl 2-(benzhydrylideneamino)-2-[1-[(4-methoxyphenyl)methyl]-5-methyl-2-oxo-4-pyridinyl]acetate |
| SMILES | COC(=O)C(N=C(c1ccccc1)c1ccccc1)c1cc(=O)n(Cc2ccc(OC)cc2)cc1C |
| InChI | InChI=1S/C30H28N2O4/c1-21-19-32(20-22-14-16-25(35-2)17-15-22)27(33)18-26(21)29(30(34)36-3)31-28(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-19,29H,20H2,1-3H3 |
| InChIKey | JIFQLJZGLKRNRP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|