C17H25F3N2O4 — CID 169193864
methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 169193864) has the molecular formula C17H25F3N2O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 169193864 |
| Molecular Formula | C17H25F3N2O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C17H25F3N2O4/c1-15(2,3)11(21-14(25)17(18,19)20)12(23)22-7-8-9(16(8,4)5)10(22)13(24)26-6/h8-11H,7H2,1-6H3,(H,21,25)/t8-,9-,10-,11+/m0/s1 |
| InChIKey | GJHCWCVNORDLJM-XWLWVQCSSA-N |
| XLogP | 1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |